C16H13F3N2O — CID 134009742
N-pyridin-4-yl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 134009742) has the molecular formula C16H13F3N2O and a molecular weight of 306.29 g/mol. Its IUPAC name is N-pyridin-4-yl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-pyridin-4-yl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134009742 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-pyridin-4-yl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccncc1)C1CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N2O/c17-16(18,19)11-3-1-10(2-4-11)13-9-14(13)15(22)21-12-5-7-20-8-6-12/h1-8,13-14H,9H2,(H,20,21,22) |
| InChIKey | JZPBCFCLUKPUFP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |