C13H14F3NO2 — CID 134162476
1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 134162476) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134162476 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CN1CC(C(=O)O)C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C13H14F3NO2/c1-17-6-10(11(7-17)12(18)19)8-2-4-9(5-3-8)13(14,15)16/h2-5,10-11H,6-7H2,1H3,(H,18,19) |
| InChIKey | KGFALSILOFQWFM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |