C14H16F3NO2 — CID 134162390
methyl 1-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate (PubChem CID 134162390) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is methyl 1-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134162390 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | methyl 1-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO2/c1-18-7-11(12(8-18)13(19)20-2)9-4-3-5-10(6-9)14(15,16)17/h3-6,11-12H,7-8H2,1-2H3 |
| InChIKey | LIOYABYFAWTLBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |