C13H14F3NO2S — CID 65171178
methyl 5-[3-(trifluoromethyl)phenyl]thiomorpholine-3-carboxylate (PubChem CID 65171178) has the molecular formula C13H14F3NO2S and a molecular weight of 305.32 g/mol. Its IUPAC name is methyl 5-[3-(trifluoromethyl)phenyl]thiomorpholine-3-carboxylate.
| Compound Name | methyl 5-[3-(trifluoromethyl)phenyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 65171178 |
| Molecular Formula | C13H14F3NO2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 5-[3-(trifluoromethyl)phenyl]thiomorpholine-3-carboxylate |
| SMILES | COC(=O)C1CSCC(c2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C13H14F3NO2S/c1-19-12(18)11-7-20-6-10(17-11)8-3-2-4-9(5-8)13(14,15)16/h2-5,10-11,17H,6-7H2,1H3 |
| InChIKey | XKKFXOWJCCMTMB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |