C13H16F3NS — CID 66228533
3,3-dimethyl-5-[3-(trifluoromethyl)phenyl]thiomorpholine (PubChem CID 66228533) has the molecular formula C13H16F3NS and a molecular weight of 275.34 g/mol. Its IUPAC name is 3,3-dimethyl-5-[3-(trifluoromethyl)phenyl]thiomorpholine.
| Compound Name | 3,3-dimethyl-5-[3-(trifluoromethyl)phenyl]thiomorpholine |
|---|---|
| PubChem CID | 66228533 |
| Molecular Formula | C13H16F3NS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3,3-dimethyl-5-[3-(trifluoromethyl)phenyl]thiomorpholine |
| SMILES | CC1(C)CSCC(c2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C13H16F3NS/c1-12(2)8-18-7-11(17-12)9-4-3-5-10(6-9)13(14,15)16/h3-6,11,17H,7-8H2,1-2H3 |
| InChIKey | SGTSDJMEXNSMQN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |