C12H15F3N2 — CID 165476719
(3S,4R)-3-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 165476719) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3S,4R)-3-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 165476719 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (3S,4R)-3-methyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | C[C@@]1(N)CNC[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2/c1-11(16)7-17-6-10(11)8-3-2-4-9(5-8)12(13,14)15/h2-5,10,17H,6-7,16H2,1H3/t10-,11+/m0/s1 |
| InChIKey | MGJHRSRVZQLENI-WDEREUQCSA-N |
| XLogP | 2.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |