C11H11F3N2O — CID 90179148
1-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 90179148) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 90179148 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | CN1CC(c2cccc(C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C11H11F3N2O/c1-16-6-9(15-10(16)17)7-3-2-4-8(5-7)11(12,13)14/h2-5,9H,6H2,1H3,(H,15,17) |
| InChIKey | VHHSFNCSQPGYLO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |