C12H13F2NO2S — CID 65170875
methyl 5-(2,5-difluorophenyl)thiomorpholine-3-carboxylate (PubChem CID 65170875) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is methyl 5-(2,5-difluorophenyl)thiomorpholine-3-carboxylate.
| Compound Name | methyl 5-(2,5-difluorophenyl)thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 65170875 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl 5-(2,5-difluorophenyl)thiomorpholine-3-carboxylate |
| SMILES | COC(=O)C1CSCC(c2cc(F)ccc2F)N1 |
| InChI | InChI=1S/C12H13F2NO2S/c1-17-12(16)11-6-18-5-10(15-11)8-4-7(13)2-3-9(8)14/h2-4,10-11,15H,5-6H2,1H3 |
| InChIKey | TZWQAWHXBULCOO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |