methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate

C10H13NO2S2 — CID 65171078

IUPACmethyl 5-thiophen-2-ylthiomorpholine-3-carboxylate
SMILESCOC(=O)C1CSCC(c2cccs2)N1
InChIInChI=1S/C10H13NO2S2/c1-13-10(12)8-6-14-5-7(11-8)9-3-2-4-15-9/h2-4,7-8,11H,5-6H2,1H3
InChIKeyKYWWIDDHEHWMAN-UHFFFAOYSA-N
MW243.35 g/mol
LogP1.67
Rot. Bonds2

About methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate

methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate (PubChem CID 65171078) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-thiophen-2-ylthiomorpholine-3-carboxylate
PubChem CID65171078
Molecular FormulaC10H13NO2S2
Molecular Weight243.35 g/mol
Exact Mass243.04
IUPAC Namemethyl 5-thiophen-2-ylthiomorpholine-3-carboxylate
SMILESCOC(=O)C1CSCC(c2cccs2)N1
InChIInChI=1S/C10H13NO2S2/c1-13-10(12)8-6-14-5-7(11-8)9-3-2-4-15-9/h2-4,7-8,11H,5-6H2,1H3
InChIKeyKYWWIDDHEHWMAN-UHFFFAOYSA-N
XLogP1.67
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.35
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate?
The IUPAC name of methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate (CID 65171078) is methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate.
What is the SMILES notation for methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate?
The canonical SMILES for methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate is COC(=O)C1CSCC(c2cccs2)N1.
What is the InChIKey of methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate?
The InChIKey is KYWWIDDHEHWMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S2/c1-13-10(12)8-6-14-5-7(11-8)9-3-2-4-15-9/h2-4,7-8,11H,5-6H2,1H3.
What are the key properties of methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate?
methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate has a molecular weight of 243.35 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-thiophen-2-ylthiomorpholine-3-carboxylate is sourced from PubChem (CID 65171078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).