About 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid
2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid (PubChem CID 175364146) has the molecular formula C13H11F3O4
and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid |
| PubChem CID | 175364146 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3O4/c14-13(15,16)8-3-1-7(2-4-8)9-5-6-12(9,10(17)18)11(19)20/h1-4,9H,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | JGDDALKTUWZVER-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid?
The IUPAC name of 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid (CID 175364146) is 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid.
What is the SMILES notation for 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid?
The canonical SMILES for 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid is O=C(O)C1(C(=O)O)CCC1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid?
The InChIKey is JGDDALKTUWZVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3O4/c14-13(15,16)8-3-1-7(2-4-8)9-5-6-12(9,10(17)18)11(19)20/h1-4,9H,5-6H2,(H,17,18)(H,19,20).
What are the key properties of 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid?
2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid has a molecular weight of 288.22 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)phenyl]cyclobutane-1,1-dicarboxylic acid is sourced from PubChem (CID 175364146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).