C15H17F3O2 — CID 67957539
2-cyclopentyl-2-[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 67957539) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-cyclopentyl-2-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67957539 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-cyclopentyl-2-[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)(c1ccc(C(F)(F)F)cc1)C1CCCC1 |
| InChI | InChI=1S/C15H17F3O2/c1-14(13(19)20,10-4-2-3-5-10)11-6-8-12(9-7-11)15(16,17)18/h6-10H,2-5H2,1H3,(H,19,20) |
| InChIKey | DCMZKSDVWCMCDW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |