C13H14F3NO — CID 116558577
2-amino-2-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 116558577) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 2-amino-2-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 116558577 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-amino-2-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CC(N)(C(=O)c1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C13H14F3NO/c1-12(17,9-6-7-9)11(18)8-2-4-10(5-3-8)13(14,15)16/h2-5,9H,6-7,17H2,1H3 |
| InChIKey | NKRFRGBHGGHVIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |