C16H20F3N3O2 — CID 119575122
N-[2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 119575122) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is N-[2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119575122 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[2-[(1-amino-2-cyclopropylpropan-2-yl)amino]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(CN)(NC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-15(9-20,11-6-7-11)22-13(23)8-21-14(24)10-2-4-12(5-3-10)16(17,18)19/h2-5,11H,6-9,20H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | XVJTZUBWCUAMNH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |