C11H15NOS — CID 116558651
2-amino-2-cyclopropyl-1-(5-methylthiophen-3-yl)propan-1-one (PubChem CID 116558651) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-1-(5-methylthiophen-3-yl)propan-1-one.
| Compound Name | 2-amino-2-cyclopropyl-1-(5-methylthiophen-3-yl)propan-1-one |
|---|---|
| PubChem CID | 116558651 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-amino-2-cyclopropyl-1-(5-methylthiophen-3-yl)propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)(N)C2CC2)cs1 |
| InChI | InChI=1S/C11H15NOS/c1-7-5-8(6-14-7)10(13)11(2,12)9-3-4-9/h5-6,9H,3-4,12H2,1-2H3 |
| InChIKey | NDLCSJOGULZBGD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |