C17H21F3N2O2 — CID 72850239
2-amino-2-methyl-1-[3-[4-(trifluoromethyl)benzoyl]piperidin-1-yl]propan-1-one (PubChem CID 72850239) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-amino-2-methyl-1-[3-[4-(trifluoromethyl)benzoyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-amino-2-methyl-1-[3-[4-(trifluoromethyl)benzoyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 72850239 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-amino-2-methyl-1-[3-[4-(trifluoromethyl)benzoyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)(N)C(=O)N1CCCC(C(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-16(2,21)15(24)22-9-3-4-12(10-22)14(23)11-5-7-13(8-6-11)17(18,19)20/h5-8,12H,3-4,9-10,21H2,1-2H3 |
| InChIKey | ANFYXXNVXKRZCM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |