C18H21F3N2O4 — CID 45232941
ethyl 2-[[3-[4-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]amino]acetate (PubChem CID 45232941) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is ethyl 2-[[3-[4-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[3-[4-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 45232941 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 2-[[3-[4-(trifluoromethyl)benzoyl]piperidine-1-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCCC(C(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H21F3N2O4/c1-2-27-15(24)10-22-17(26)23-9-3-4-13(11-23)16(25)12-5-7-14(8-6-12)18(19,20)21/h5-8,13H,2-4,9-11H2,1H3,(H,22,26) |
| InChIKey | KIHCHHUPRPMMKC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |