C14H15F3O2 — CID 83154745
2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 83154745) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 83154745 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C14H15F3O2/c1-13(12(18)19,10-6-7-10)8-9-2-4-11(5-3-9)14(15,16)17/h2-5,10H,6-8H2,1H3,(H,18,19) |
| InChIKey | BYXSUOZNXDYNHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |