C13H13F3O5 — CID 142389020
2-ethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioic acid (PubChem CID 142389020) has the molecular formula C13H13F3O5 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-ethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-ethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 142389020 |
| Molecular Formula | C13H13F3O5 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-ethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioic acid |
| SMILES | CCOC(Cc1ccc(C(F)(F)F)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H13F3O5/c1-2-21-12(10(17)18,11(19)20)7-8-3-5-9(6-4-8)13(14,15)16/h3-6H,2,7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | FMBJMMAFBOARGH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|