C14H15F3O3 — CID 62906139
4-[[4-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid (PubChem CID 62906139) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[4-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 62906139 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[[4-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(C(F)(F)F)cc2)CCOCC1 |
| InChI | InChI=1S/C14H15F3O3/c15-14(16,17)11-3-1-10(2-4-11)9-13(12(18)19)5-7-20-8-6-13/h1-4H,5-9H2,(H,18,19) |
| InChIKey | AKBQCXLIOBJPJV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |