4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid

C15H20O3 — CID 55132767

IUPAC4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid
SMILESCc1ccc(CC2(C(=O)O)CCOCC2)cc1C
InChIInChI=1S/C15H20O3/c1-11-3-4-13(9-12(11)2)10-15(14(16)17)5-7-18-8-6-15/h3-4,9H,5-8,10H2,1-2H3,(H,16,17)
InChIKeyDYLJHDKHIINWGC-UHFFFAOYSA-N
MW248.32 g/mol
LogP2.73
Rot. Bonds3

About 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid

4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid (PubChem CID 55132767) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid.

Molecular Properties

Compound Name4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid
PubChem CID55132767
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Name4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid
SMILESCc1ccc(CC2(C(=O)O)CCOCC2)cc1C
InChIInChI=1S/C15H20O3/c1-11-3-4-13(9-12(11)2)10-15(14(16)17)5-7-18-8-6-15/h3-4,9H,5-8,10H2,1-2H3,(H,16,17)
InChIKeyDYLJHDKHIINWGC-UHFFFAOYSA-N
XLogP2.73
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid?
The IUPAC name of 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid (CID 55132767) is 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid.
What is the SMILES notation for 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid?
The canonical SMILES for 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid is Cc1ccc(CC2(C(=O)O)CCOCC2)cc1C.
What is the InChIKey of 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid?
The InChIKey is DYLJHDKHIINWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-11-3-4-13(9-12(11)2)10-15(14(16)17)5-7-18-8-6-15/h3-4,9H,5-8,10H2,1-2H3,(H,16,17).
What are the key properties of 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid?
4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid has a molecular weight of 248.32 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylphenyl)methyl]oxane-4-carboxylic acid is sourced from PubChem (CID 55132767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).