C14H19NO2 — CID 116604621
(4-aminooxan-4-yl)-(3,4-dimethylphenyl)methanone (PubChem CID 116604621) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4-aminooxan-4-yl)-(3,4-dimethylphenyl)methanone.
| Compound Name | (4-aminooxan-4-yl)-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 116604621 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4-aminooxan-4-yl)-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2(N)CCOCC2)cc1C |
| InChI | InChI=1S/C14H19NO2/c1-10-3-4-12(9-11(10)2)13(16)14(15)5-7-17-8-6-14/h3-4,9H,5-8,15H2,1-2H3 |
| InChIKey | PRMZXDGWDMYGES-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |