C23H24F3NO3 — CID 22240979
4-benzyl-1-[3-[4-(trifluoromethyl)phenyl]propanoyl]piperidine-4-carboxylic acid (PubChem CID 22240979) has the molecular formula C23H24F3NO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-benzyl-1-[3-[4-(trifluoromethyl)phenyl]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-[3-[4-(trifluoromethyl)phenyl]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22240979 |
| Molecular Formula | C23H24F3NO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-benzyl-1-[3-[4-(trifluoromethyl)phenyl]propanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(CCc1ccc(C(F)(F)F)cc1)N1CCC(Cc2ccccc2)(C(=O)O)CC1 |
| InChI | InChI=1S/C23H24F3NO3/c24-23(25,26)19-9-6-17(7-10-19)8-11-20(28)27-14-12-22(13-15-27,21(29)30)16-18-4-2-1-3-5-18/h1-7,9-10H,8,11-16H2,(H,29,30) |
| InChIKey | YAOCLWHVIUBPNQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |