C28H31N3O2 — CID 95805527
N-methyl-1-(3-phenylpropanoyl)-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 95805527) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-methyl-1-(3-phenylpropanoyl)-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(3-phenylpropanoyl)-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95805527 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-methyl-1-(3-phenylpropanoyl)-4-[(2-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1(Cc2ccccc2-c2ccncc2)CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H31N3O2/c1-29-27(33)28(21-24-9-5-6-10-25(24)23-13-17-30-18-14-23)15-19-31(20-16-28)26(32)12-11-22-7-3-2-4-8-22/h2-10,13-14,17-18H,11-12,15-16,19-21H2,1H3,(H,29,33) |
| InChIKey | WCWRRTGCKFUYBA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |