C23H28N2O2 — CID 92586242
(3S)-1-butanoyl-N-methyl-3-[(2-phenylphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 92586242) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S)-1-butanoyl-N-methyl-3-[(2-phenylphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-butanoyl-N-methyl-3-[(2-phenylphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92586242 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3S)-1-butanoyl-N-methyl-3-[(2-phenylphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | CCCC(=O)N1CC[C@](Cc2ccccc2-c2ccccc2)(C(=O)NC)C1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-9-21(26)25-15-14-23(17-25,22(27)24-2)16-19-12-7-8-13-20(19)18-10-5-4-6-11-18/h4-8,10-13H,3,9,14-17H2,1-2H3,(H,24,27)/t23-/m1/s1 |
| InChIKey | QYVMUSCGSGQSIJ-HSZRJFAPSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |