C19H17F3O3 — CID 162181863
phenyl 2-[3-cyclobutyloxy-5-(trifluoromethyl)phenyl]acetate (PubChem CID 162181863) has the molecular formula C19H17F3O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is phenyl 2-[3-cyclobutyloxy-5-(trifluoromethyl)phenyl]acetate.
| Compound Name | phenyl 2-[3-cyclobutyloxy-5-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 162181863 |
| Molecular Formula | C19H17F3O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | phenyl 2-[3-cyclobutyloxy-5-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(Cc1cc(OC2CCC2)cc(C(F)(F)F)c1)Oc1ccccc1 |
| InChI | InChI=1S/C19H17F3O3/c20-19(21,22)14-9-13(10-17(12-14)24-15-7-4-8-15)11-18(23)25-16-5-2-1-3-6-16/h1-3,5-6,9-10,12,15H,4,7-8,11H2 |
| InChIKey | ZPDCKYIKPSWFHP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|