C20H19F4NO2 — CID 161285747
phenyl 2-[3-(4-fluoropiperidin-1-yl)-5-(trifluoromethyl)phenyl]acetate (PubChem CID 161285747) has the molecular formula C20H19F4NO2 and a molecular weight of 381.37 g/mol. Its IUPAC name is phenyl 2-[3-(4-fluoropiperidin-1-yl)-5-(trifluoromethyl)phenyl]acetate.
| Compound Name | phenyl 2-[3-(4-fluoropiperidin-1-yl)-5-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 161285747 |
| Molecular Formula | C20H19F4NO2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | phenyl 2-[3-(4-fluoropiperidin-1-yl)-5-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(Cc1cc(N2CCC(F)CC2)cc(C(F)(F)F)c1)Oc1ccccc1 |
| InChI | InChI=1S/C20H19F4NO2/c21-16-6-8-25(9-7-16)17-11-14(10-15(13-17)20(22,23)24)12-19(26)27-18-4-2-1-3-5-18/h1-5,10-11,13,16H,6-9,12H2 |
| InChIKey | VFRRIMUCJWKTRQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|