C16H12F3NO3 — CID 8803312
(4-carbamoylphenyl) 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 8803312) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is (4-carbamoylphenyl) 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | (4-carbamoylphenyl) 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 8803312 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (4-carbamoylphenyl) 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | NC(=O)c1ccc(OC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H12F3NO3/c17-16(18,19)12-3-1-2-10(8-12)9-14(21)23-13-6-4-11(5-7-13)15(20)22/h1-8H,9H2,(H2,20,22) |
| InChIKey | CWSQNPFGYQOKFB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|