C9H10F3N3 — CID 77077245
N'-amino-2-[3-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 77077245) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is N'-amino-2-[3-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | N'-amino-2-[3-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 77077245 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N'-amino-2-[3-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | NN=C(N)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3N3/c10-9(11,12)7-3-1-2-6(4-7)5-8(13)15-14/h1-4H,5,14H2,(H2,13,15) |
| InChIKey | JSZIJHRCJONIKT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|