C12H7F9O3S — CID 141497500
4,4,4-trifluoro-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]but-2-ene-2-sulfonic acid (PubChem CID 141497500) has the molecular formula C12H7F9O3S and a molecular weight of 402.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]but-2-ene-2-sulfonic acid.
| Compound Name | 4,4,4-trifluoro-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]but-2-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 141497500 |
| Molecular Formula | C12H7F9O3S |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4,4,4-trifluoro-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]but-2-ene-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(Cc1cccc(C(F)(F)F)c1)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F9O3S/c13-10(14,15)7-3-1-2-6(4-7)5-8(25(22,23)24)9(11(16,17)18)12(19,20)21/h1-4H,5H2,(H,22,23,24) |
| InChIKey | YEOUWHBVFWFGTA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|