C8H9F3NO2P — CID 57291400
[3-(trifluoromethyl)phenyl]methylphosphonamidic acid (PubChem CID 57291400) has the molecular formula C8H9F3NO2P and a molecular weight of 239.13 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methylphosphonamidic acid.
| Compound Name | [3-(trifluoromethyl)phenyl]methylphosphonamidic acid |
|---|---|
| PubChem CID | 57291400 |
| Molecular Formula | C8H9F3NO2P |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methylphosphonamidic acid |
| SMILES | NP(=O)(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H9F3NO2P/c9-8(10,11)7-3-1-2-6(4-7)5-15(12,13)14/h1-4H,5H2,(H3,12,13,14) |
| InChIKey | PXEGJNUGCYSPTF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|