C15H18F3O6P — CID 19357676
2-[1-[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]ethyl]pentanedioic acid (PubChem CID 19357676) has the molecular formula C15H18F3O6P and a molecular weight of 382.27 g/mol. Its IUPAC name is 2-[1-[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]ethyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357676 |
| Molecular Formula | C15H18F3O6P |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[1-[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]ethyl]pentanedioic acid |
| SMILES | CC(C(CCC(=O)O)C(=O)O)P(=O)(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3O6P/c1-9(12(14(21)22)5-6-13(19)20)25(23,24)8-10-3-2-4-11(7-10)15(16,17)18/h2-4,7,9,12H,5-6,8H2,1H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | YMEMUUKZWAQHDE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|