C15H15F6O6P — CID 10884611
2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 10884611) has the molecular formula C15H15F6O6P and a molecular weight of 436.24 g/mol. Its IUPAC name is 2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 10884611 |
| Molecular Formula | C15H15F6O6P |
| Molecular Weight | 436.24 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C15H15F6O6P/c16-14(17,18)10-3-8(4-11(5-10)15(19,20)21)6-28(26,27)7-9(13(24)25)1-2-12(22)23/h3-5,9H,1-2,6-7H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | NABFGFPVXGGGSD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|