C11H19O8P — CID 88884036
2-[[4-carboxybutyl(hydroxy)phosphoryl]methyl]pentanedioic acid (PubChem CID 88884036) has the molecular formula C11H19O8P and a molecular weight of 310.24 g/mol. Its IUPAC name is 2-[[4-carboxybutyl(hydroxy)phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[4-carboxybutyl(hydroxy)phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 88884036 |
| Molecular Formula | C11H19O8P |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[[4-carboxybutyl(hydroxy)phosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCCCP(=O)(O)CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19O8P/c12-9(13)3-1-2-6-20(18,19)7-8(11(16)17)4-5-10(14)15/h8H,1-7H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | ZCOQJHDZXLVGOH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|