C25H43N6O14P — CID 23629841
2-[[hydroxy-[3-oxo-3-[2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]hydrazinyl]propyl]phosphoryl]methyl]pentanedioic acid (PubChem CID 23629841) has the molecular formula C25H43N6O14P and a molecular weight of 682.62 g/mol. Its IUPAC name is 2-[[hydroxy-[3-oxo-3-[2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]hydrazinyl]propyl]phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy-[3-oxo-3-[2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]hydrazinyl]propyl]phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 23629841 |
| Molecular Formula | C25H43N6O14P |
| Molecular Weight | 682.62 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 2-[[hydroxy-[3-oxo-3-[2-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]hydrazinyl]propyl]phosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)CCC(=O)NNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C25H43N6O14P/c32-19(3-12-46(44,45)17-18(25(42)43)1-2-21(34)35)26-27-20(33)13-28-4-6-29(14-22(36)37)8-10-31(16-24(40)41)11-9-30(7-5-28)15-23(38)39/h18H,1-17H2,(H,26,32)(H,27,33)(H,34,35)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | NREUPPLTAMVLGB-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 294.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.62 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|