C19H37N5O13P2 — CID 126483408
2-[4,7-bis(carboxymethyl)-10-[2-(1,1-diphosphonopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 126483408) has the molecular formula C19H37N5O13P2 and a molecular weight of 605.48 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(1,1-diphosphonopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1,1-diphosphonopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 126483408 |
| Molecular Formula | C19H37N5O13P2 |
| Molecular Weight | 605.48 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1,1-diphosphonopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCC(NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C19H37N5O13P2/c1-2-19(38(32,33)34,39(35,36)37)20-15(25)11-21-3-5-22(12-16(26)27)7-9-24(14-18(30)31)10-8-23(6-4-21)13-17(28)29/h2-14H2,1H3,(H,20,25)(H,26,27)(H,28,29)(H,30,31)(H2,32,33,34)(H2,35,36,37) |
| InChIKey | CDRJHODRRALHTJ-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 269.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.48 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|