C21H40N5O16P2+ — CID 126483355
2-[4,7,10-tris(carboxymethyl)-7-[2-(1,1-diphosphonopropylamino)-1-hydroxy-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododec-1-yl]acetic acid (PubChem CID 126483355) has the molecular formula C21H40N5O16P2+ and a molecular weight of 680.52 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-7-[2-(1,1-diphosphonopropylamino)-1-hydroxy-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-7-[2-(1,1-diphosphonopropylamino)-1-hydroxy-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 126483355 |
| Molecular Formula | C21H40N5O16P2+ |
| Molecular Weight | 680.52 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-7-[2-(1,1-diphosphonopropylamino)-1-hydroxy-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododec-1-yl]acetic acid |
| SMILES | CCC(NC(=O)C(O)[N+]1(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C21H39N5O16P2/c1-2-21(43(37,38)39,44(40,41)42)22-19(35)20(36)26(14-18(33)34)9-7-24(12-16(29)30)5-3-23(11-15(27)28)4-6-25(8-10-26)13-17(31)32/h20,36H,2-14H2,1H3,(H8-,22,27,28,29,30,31,32,33,34,35,37,38,39,40,41,42)/p+1 |
| InChIKey | PUXKHJSXKXNFQN-UHFFFAOYSA-O |
| XLogP | -4.09 |
| TPSA | 323.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.52 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|