2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid

C8H17N2O2+ — CID 11630800

IUPAC2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid
SMILESC[N+]1(C)CCN(CC(=O)O)CC1
InChIInChI=1S/C8H16N2O2/c1-10(2)5-3-9(4-6-10)7-8(11)12/h3-7H2,1-2H3/p+1
InChIKeyFNTIPILTLXMRQA-UHFFFAOYSA-O
MW173.24 g/mol
LogP-0.54
Rot. Bonds2

About 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid

2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid (PubChem CID 11630800) has the molecular formula C8H17N2O2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid
PubChem CID11630800
Molecular FormulaC8H17N2O2+
Molecular Weight173.24 g/mol
Exact Mass173.13
IUPAC Name2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid
SMILESC[N+]1(C)CCN(CC(=O)O)CC1
InChIInChI=1S/C8H16N2O2/c1-10(2)5-3-9(4-6-10)7-8(11)12/h3-7H2,1-2H3/p+1
InChIKeyFNTIPILTLXMRQA-UHFFFAOYSA-O
XLogP-0.54
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.24
LogP ≤ 5-0.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid?
The IUPAC name of 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid (CID 11630800) is 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid.
What is the SMILES notation for 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid?
The canonical SMILES for 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid is C[N+]1(C)CCN(CC(=O)O)CC1.
What is the InChIKey of 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid?
The InChIKey is FNTIPILTLXMRQA-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H16N2O2/c1-10(2)5-3-9(4-6-10)7-8(11)12/h3-7H2,1-2H3/p+1.
What are the key properties of 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid?
2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid has a molecular weight of 173.24 g/mol, XLogP of -0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid is sourced from PubChem (CID 11630800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).