C8H17N2O2+ — CID 11630800
2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid (PubChem CID 11630800) has the molecular formula C8H17N2O2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid.
| Compound Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid |
|---|---|
| PubChem CID | 11630800 |
| Molecular Formula | C8H17N2O2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)acetic acid |
| SMILES | C[N+]1(C)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C8H16N2O2/c1-10(2)5-3-9(4-6-10)7-8(11)12/h3-7H2,1-2H3/p+1 |
| InChIKey | FNTIPILTLXMRQA-UHFFFAOYSA-O |
| XLogP | -0.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|