C16H30N4O6S — CID 163288691
2-[4,10-bis(carboxymethyl)-7-ethylsulfanyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 163288691) has the molecular formula C16H30N4O6S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-ethylsulfanyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-ethylsulfanyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 163288691 |
| Molecular Formula | C16H30N4O6S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-ethylsulfanyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCSN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H30N4O6S/c1-2-27-20-9-7-18(12-15(23)24)5-3-17(11-14(21)22)4-6-19(8-10-20)13-16(25)26/h2-13H2,1H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | AHRBGVZPAPUYLU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|