C20H39N4O9P — CID 91338855
2-[4,7-bis(carboxymethyl)-10-(2-diethoxyphosphorylethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 91338855) has the molecular formula C20H39N4O9P and a molecular weight of 510.53 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-(2-diethoxyphosphorylethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-(2-diethoxyphosphorylethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 91338855 |
| Molecular Formula | C20H39N4O9P |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-(2-diethoxyphosphorylethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCOP(=O)(CCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)OCC |
| InChI | InChI=1S/C20H39N4O9P/c1-3-32-34(31,33-4-2)14-13-21-5-7-22(15-18(25)26)9-11-24(17-20(29)30)12-10-23(8-6-21)16-19(27)28/h3-17H2,1-2H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | PEZIGPZPDHGEQS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|