C24H48GdN4O16P4+3 — CID 71466549
gadolinium(3+);3-[hydroxy-[[4,7,10-tris[[2-carboxyethyl(hydroxy)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phosphoryl]propanoic acid (PubChem CID 71466549) has the molecular formula C24H48GdN4O16P4+3 and a molecular weight of 929.81 g/mol. Its IUPAC name is gadolinium(3+);3-[hydroxy-[[4,7,10-tris[[2-carboxyethyl(hydroxy)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phosphoryl]propanoic acid.
| Compound Name | gadolinium(3+);3-[hydroxy-[[4,7,10-tris[[2-carboxyethyl(hydroxy)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 71466549 |
| Molecular Formula | C24H48GdN4O16P4+3 |
| Molecular Weight | 929.81 g/mol |
| Exact Mass | 930.12 |
| IUPAC Name | gadolinium(3+);3-[hydroxy-[[4,7,10-tris[[2-carboxyethyl(hydroxy)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phosphoryl]propanoic acid |
| SMILES | O=C(O)CCP(=O)(O)CN1CCN(CP(=O)(O)CCC(=O)O)CCN(CP(=O)(O)CCC(=O)O)CCN(CP(=O)(O)CCC(=O)O)CC1.[Gd+3] |
| InChI | InChI=1S/C24H48N4O16P4.Gd/c29-21(30)1-13-45(37,38)17-25-5-7-26(18-46(39,40)14-2-22(31)32)9-11-28(20-48(43,44)16-4-24(35)36)12-10-27(8-6-25)19-47(41,42)15-3-23(33)34;/h1-20H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44);/q;+3 |
| InChIKey | HTBKBFKORVDWFZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 311.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.81 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|