C12H32HoN4O12P4+3 — CID 10327494
holmium-166(3+);[4,7,10-tris(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methylphosphonic acid (PubChem CID 10327494) has the molecular formula C12H32HoN4O12P4+3 and a molecular weight of 714.23 g/mol. Its IUPAC name is holmium-166(3+);[4,7,10-tris(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methylphosphonic acid.
| Compound Name | holmium-166(3+);[4,7,10-tris(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 10327494 |
| Molecular Formula | C12H32HoN4O12P4+3 |
| Molecular Weight | 714.23 g/mol |
| Exact Mass | 714.03 |
| IUPAC Name | holmium-166(3+);[4,7,10-tris(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)CC1.[166Ho+3] |
| InChI | InChI=1S/C12H32N4O12P4.Ho/c17-29(18,19)9-13-1-2-14(10-30(20,21)22)5-6-16(12-32(26,27)28)8-7-15(4-3-13)11-31(23,24)25;/h1-12H2,(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28);/q;+3/i;1+1 |
| InChIKey | NJFJWUQSWQWLKG-IEOVAKBOSA-N |
| XLogP | -2.25 |
| TPSA | 243.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.23 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|