C11H26N3O3P — CID 175613741
(4,7-diethyl-1,4,7-triazonan-1-yl)methylphosphonic acid (PubChem CID 175613741) has the molecular formula C11H26N3O3P and a molecular weight of 279.32 g/mol. Its IUPAC name is (4,7-diethyl-1,4,7-triazonan-1-yl)methylphosphonic acid.
| Compound Name | (4,7-diethyl-1,4,7-triazonan-1-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 175613741 |
| Molecular Formula | C11H26N3O3P |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (4,7-diethyl-1,4,7-triazonan-1-yl)methylphosphonic acid |
| SMILES | CCN1CCN(CC)CCN(CP(=O)(O)O)CC1 |
| InChI | InChI=1S/C11H26N3O3P/c1-3-12-5-6-13(4-2)8-10-14(9-7-12)11-18(15,16)17/h3-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | KTJHFGASJIVHKE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|