C4H11NO6P2 — CID 15936130
(2-hydroxy-2-oxo-1,4,2lambda5-oxazaphosphinan-4-yl)methylphosphonic acid (PubChem CID 15936130) has the molecular formula C4H11NO6P2 and a molecular weight of 231.08 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,4,2lambda5-oxazaphosphinan-4-yl)methylphosphonic acid.
| Compound Name | (2-hydroxy-2-oxo-1,4,2lambda5-oxazaphosphinan-4-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 15936130 |
| Molecular Formula | C4H11NO6P2 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | (2-hydroxy-2-oxo-1,4,2lambda5-oxazaphosphinan-4-yl)methylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCOP(=O)(O)C1 |
| InChI | InChI=1S/C4H11NO6P2/c6-12(7,8)3-5-1-2-11-13(9,10)4-5/h1-4H2,(H,9,10)(H2,6,7,8) |
| InChIKey | BFEMYVYZNSBRML-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|