C15H34N2O9P2 — CID 154388192
[4-(phosphonomethyl)-1,7,10-trioxa-4,13-diazacyclooctadec-13-yl]methylphosphonic acid (PubChem CID 154388192) has the molecular formula C15H34N2O9P2 and a molecular weight of 448.39 g/mol. Its IUPAC name is [4-(phosphonomethyl)-1,7,10-trioxa-4,13-diazacyclooctadec-13-yl]methylphosphonic acid.
| Compound Name | [4-(phosphonomethyl)-1,7,10-trioxa-4,13-diazacyclooctadec-13-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 154388192 |
| Molecular Formula | C15H34N2O9P2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [4-(phosphonomethyl)-1,7,10-trioxa-4,13-diazacyclooctadec-13-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCCCCOCCN(CP(=O)(O)O)CCOCCOCC1 |
| InChI | InChI=1S/C15H34N2O9P2/c18-27(19,20)14-16-4-2-1-3-8-24-9-6-17(15-28(21,22)23)7-11-26-13-12-25-10-5-16/h1-15H2,(H2,18,19,20)(H2,21,22,23) |
| InChIKey | FPQXIAWHSLBJIW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|