C13H28NO8P — CID 101017054
1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethylphosphonic acid (PubChem CID 101017054) has the molecular formula C13H28NO8P and a molecular weight of 357.34 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethylphosphonic acid.
| Compound Name | 1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethylphosphonic acid |
|---|---|
| PubChem CID | 101017054 |
| Molecular Formula | C13H28NO8P |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCOCCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C13H28NO8P/c15-23(16,17)13-14-1-3-18-5-7-20-9-11-22-12-10-21-8-6-19-4-2-14/h1-13H2,(H2,15,16,17) |
| InChIKey | PKLKMPMRDSQLEA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|