C10H28N4O12P4 — CID 10168842
[1,2,8-tris(phosphonomethyl)-1,2,5,8-tetrazecan-5-yl]methylphosphonic acid (PubChem CID 10168842) has the molecular formula C10H28N4O12P4 and a molecular weight of 520.25 g/mol. Its IUPAC name is [1,2,8-tris(phosphonomethyl)-1,2,5,8-tetrazecan-5-yl]methylphosphonic acid.
| Compound Name | [1,2,8-tris(phosphonomethyl)-1,2,5,8-tetrazecan-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 10168842 |
| Molecular Formula | C10H28N4O12P4 |
| Molecular Weight | 520.25 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [1,2,8-tris(phosphonomethyl)-1,2,5,8-tetrazecan-5-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)N(CP(=O)(O)O)CC1 |
| InChI | InChI=1S/C10H28N4O12P4/c15-27(16,17)7-11-1-2-12(8-28(18,19)20)4-6-14(10-30(24,25)26)13(5-3-11)9-29(21,22)23/h1-10H2,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26) |
| InChIKey | ALCMCKQJEZZQEJ-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 243.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.25 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|