C17H31N4O11P — CID 44634005
2-[4,10-bis(carboxymethyl)-7-(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanedioic acid (PubChem CID 44634005) has the molecular formula C17H31N4O11P and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanedioic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanedioic acid |
|---|---|
| PubChem CID | 44634005 |
| Molecular Formula | C17H31N4O11P |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N1CCN(CC(=O)O)CCN(CP(=O)(O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H31N4O11P/c22-14(23)9-13(17(28)29)21-7-5-18(10-15(24)25)1-3-20(12-33(30,31)32)4-2-19(6-8-21)11-16(26)27/h13H,1-12H2,(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H2,30,31,32) |
| InChIKey | RUOGPXAIYFJPFJ-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 219.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|