C12H16F3N2O3P — CID 162536662
[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylphosphonic acid (PubChem CID 162536662) has the molecular formula C12H16F3N2O3P and a molecular weight of 324.24 g/mol. Its IUPAC name is [4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylphosphonic acid.
| Compound Name | [4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 162536662 |
| Molecular Formula | C12H16F3N2O3P |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)CN1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C12H16F3N2O3P/c13-12(14,15)10-1-3-11(4-2-10)17-7-5-16(6-8-17)9-21(18,19)20/h1-4H,5-9H2,(H2,18,19,20) |
| InChIKey | PIIJUKYYOQMVGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|