C15H19F3N4O2 — CID 75431410
N-carbamoyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 75431410) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-carbamoyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | N-carbamoyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 75431410 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-carbamoyl-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | NC(=O)NC(=O)CCN1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H19F3N4O2/c16-15(17,18)11-1-3-12(4-2-11)22-9-7-21(8-10-22)6-5-13(23)20-14(19)24/h1-4H,5-10H2,(H3,19,20,23,24) |
| InChIKey | PPOMEUPBQYWRSI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |