C22H25F3N4O2 — CID 90408631
[4-[3-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]urea (PubChem CID 90408631) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is [4-[3-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]urea.
| Compound Name | [4-[3-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]urea |
|---|---|
| PubChem CID | 90408631 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [4-[3-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(CCC(=O)CN2CCN(c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25F3N4O2/c23-22(24,25)17-4-8-19(9-5-17)29-13-11-28(12-14-29)15-20(30)10-3-16-1-6-18(7-2-16)27-21(26)31/h1-2,4-9H,3,10-15H2,(H3,26,27,31) |
| InChIKey | DGZRCHNMEALXTH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |